C11H19NO2S3 — CID 55246225
1-(2-methylsulfonylethylsulfanyl)-1-thiophen-3-ylbutan-2-amine (PubChem CID 55246225) has the molecular formula C11H19NO2S3 and a molecular weight of 293.48 g/mol. Its IUPAC name is 1-(2-methylsulfonylethylsulfanyl)-1-thiophen-3-ylbutan-2-amine.
| Compound Name | 1-(2-methylsulfonylethylsulfanyl)-1-thiophen-3-ylbutan-2-amine |
|---|---|
| PubChem CID | 55246225 |
| Molecular Formula | C11H19NO2S3 |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 1-(2-methylsulfonylethylsulfanyl)-1-thiophen-3-ylbutan-2-amine |
| SMILES | CCC(N)C(SCCS(C)(=O)=O)c1ccsc1 |
| InChI | InChI=1S/C11H19NO2S3/c1-3-10(12)11(9-4-5-15-8-9)16-6-7-17(2,13)14/h4-5,8,10-11H,3,6-7,12H2,1-2H3 |
| InChIKey | MJKWUWRQHIVFPM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |