C13H15N5S2 — CID 62253229
1-(7H-purin-6-ylsulfanyl)-1-thiophen-3-ylbutan-2-amine (PubChem CID 62253229) has the molecular formula C13H15N5S2 and a molecular weight of 305.43 g/mol. Its IUPAC name is 1-(7H-purin-6-ylsulfanyl)-1-thiophen-3-ylbutan-2-amine.
| Compound Name | 1-(7H-purin-6-ylsulfanyl)-1-thiophen-3-ylbutan-2-amine |
|---|---|
| PubChem CID | 62253229 |
| Molecular Formula | C13H15N5S2 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 1-(7H-purin-6-ylsulfanyl)-1-thiophen-3-ylbutan-2-amine |
| SMILES | CCC(N)C(Sc1ncnc2nc[nH]c12)c1ccsc1 |
| InChI | InChI=1S/C13H15N5S2/c1-2-9(14)11(8-3-4-19-5-8)20-13-10-12(16-6-15-10)17-7-18-13/h3-7,9,11H,2,14H2,1H3,(H,15,16,17,18) |
| InChIKey | VJSOQIOONSTVDL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |