C14H15N5S — CID 62253055
2-(2-methylphenyl)-2-(7H-purin-6-ylsulfanyl)ethanamine (PubChem CID 62253055) has the molecular formula C14H15N5S and a molecular weight of 285.38 g/mol. Its IUPAC name is 2-(2-methylphenyl)-2-(7H-purin-6-ylsulfanyl)ethanamine.
| Compound Name | 2-(2-methylphenyl)-2-(7H-purin-6-ylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 62253055 |
| Molecular Formula | C14H15N5S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-(2-methylphenyl)-2-(7H-purin-6-ylsulfanyl)ethanamine |
| SMILES | Cc1ccccc1C(CN)Sc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C14H15N5S/c1-9-4-2-3-5-10(9)11(6-15)20-14-12-13(17-7-16-12)18-8-19-14/h2-5,7-8,11H,6,15H2,1H3,(H,16,17,18,19) |
| InChIKey | HVWRVLDSAJFRLF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |