C14H16N6S — CID 62253603
1-(7H-purin-6-ylsulfanyl)-1-pyridin-2-ylbutan-2-amine (PubChem CID 62253603) has the molecular formula C14H16N6S and a molecular weight of 300.39 g/mol. Its IUPAC name is 1-(7H-purin-6-ylsulfanyl)-1-pyridin-2-ylbutan-2-amine.
| Compound Name | 1-(7H-purin-6-ylsulfanyl)-1-pyridin-2-ylbutan-2-amine |
|---|---|
| PubChem CID | 62253603 |
| Molecular Formula | C14H16N6S |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 1-(7H-purin-6-ylsulfanyl)-1-pyridin-2-ylbutan-2-amine |
| SMILES | CCC(N)C(Sc1ncnc2nc[nH]c12)c1ccccn1 |
| InChI | InChI=1S/C14H16N6S/c1-2-9(15)12(10-5-3-4-6-16-10)21-14-11-13(18-7-17-11)19-8-20-14/h3-9,12H,2,15H2,1H3,(H,17,18,19,20) |
| InChIKey | SJCSMELYYFAILE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |