C16H13N5OS — CID 95775864
5-phenyl-2-[(1S)-1-(7H-purin-6-ylsulfanyl)ethyl]-1,3-oxazole (PubChem CID 95775864) has the molecular formula C16H13N5OS and a molecular weight of 323.38 g/mol. Its IUPAC name is 5-phenyl-2-[(1S)-1-(7H-purin-6-ylsulfanyl)ethyl]-1,3-oxazole.
| Compound Name | 5-phenyl-2-[(1S)-1-(7H-purin-6-ylsulfanyl)ethyl]-1,3-oxazole |
|---|---|
| PubChem CID | 95775864 |
| Molecular Formula | C16H13N5OS |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 5-phenyl-2-[(1S)-1-(7H-purin-6-ylsulfanyl)ethyl]-1,3-oxazole |
| SMILES | C[C@H](Sc1ncnc2nc[nH]c12)c1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C16H13N5OS/c1-10(23-16-13-14(19-8-18-13)20-9-21-16)15-17-7-12(22-15)11-5-3-2-4-6-11/h2-10H,1H3,(H,18,19,20,21)/t10-/m0/s1 |
| InChIKey | QLPXRPJBVVHYRP-JTQLQIEISA-N |
| XLogP | 3.86 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |