C13H15N5OS — CID 62255029
1-(5-methylfuran-2-yl)-1-(7H-purin-6-ylsulfanyl)propan-2-amine (PubChem CID 62255029) has the molecular formula C13H15N5OS and a molecular weight of 289.36 g/mol. Its IUPAC name is 1-(5-methylfuran-2-yl)-1-(7H-purin-6-ylsulfanyl)propan-2-amine.
| Compound Name | 1-(5-methylfuran-2-yl)-1-(7H-purin-6-ylsulfanyl)propan-2-amine |
|---|---|
| PubChem CID | 62255029 |
| Molecular Formula | C13H15N5OS |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 1-(5-methylfuran-2-yl)-1-(7H-purin-6-ylsulfanyl)propan-2-amine |
| SMILES | Cc1ccc(C(Sc2ncnc3nc[nH]c23)C(C)N)o1 |
| InChI | InChI=1S/C13H15N5OS/c1-7-3-4-9(19-7)11(8(2)14)20-13-10-12(16-5-15-10)17-6-18-13/h3-6,8,11H,14H2,1-2H3,(H,15,16,17,18) |
| InChIKey | MCOMHUWGYCSWIM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |