About 5-amino-2-ethynylbenzoic acid
5-amino-2-ethynylbenzoic acid (PubChem CID 55265577) has the molecular formula C9H7NO2
and a molecular weight of 161.16 g/mol. Its IUPAC name is 5-amino-2-ethynylbenzoic acid.
Molecular Properties
| Compound Name | 5-amino-2-ethynylbenzoic acid |
| PubChem CID | 55265577 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 5-amino-2-ethynylbenzoic acid |
| SMILES | C#Cc1ccc(N)cc1C(=O)O |
| InChI | InChI=1S/C9H7NO2/c1-2-6-3-4-7(10)5-8(6)9(11)12/h1,3-5H,10H2,(H,11,12) |
| InChIKey | HKCYOMXPYFHWLS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-ethynylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-ethynylbenzoic acid?
The IUPAC name of 5-amino-2-ethynylbenzoic acid (CID 55265577) is 5-amino-2-ethynylbenzoic acid.
What is the SMILES notation for 5-amino-2-ethynylbenzoic acid?
The canonical SMILES for 5-amino-2-ethynylbenzoic acid is C#Cc1ccc(N)cc1C(=O)O.
What is the InChIKey of 5-amino-2-ethynylbenzoic acid?
The InChIKey is HKCYOMXPYFHWLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2/c1-2-6-3-4-7(10)5-8(6)9(11)12/h1,3-5H,10H2,(H,11,12).
What are the key properties of 5-amino-2-ethynylbenzoic acid?
5-amino-2-ethynylbenzoic acid has a molecular weight of 161.16 g/mol, XLogP of 0.95, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-ethynylbenzoic acid is sourced from PubChem (CID 55265577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).