4-amino-3-ethynylbenzoic acid

C9H7NO2 — CID 55265470

IUPAC4-amino-3-ethynylbenzoic acid
SMILESC#Cc1cc(C(=O)O)ccc1N
InChIInChI=1S/C9H7NO2/c1-2-6-5-7(9(11)12)3-4-8(6)10/h1,3-5H,10H2,(H,11,12)
InChIKeyPUWJKDDCTXOCBQ-UHFFFAOYSA-N
MW161.16 g/mol
LogP0.95
Rot. Bonds1

About 4-amino-3-ethynylbenzoic acid

4-amino-3-ethynylbenzoic acid (PubChem CID 55265470) has the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. Its IUPAC name is 4-amino-3-ethynylbenzoic acid.

Molecular Properties

Compound Name4-amino-3-ethynylbenzoic acid
PubChem CID55265470
Molecular FormulaC9H7NO2
Molecular Weight161.16 g/mol
Exact Mass161.05
IUPAC Name4-amino-3-ethynylbenzoic acid
SMILESC#Cc1cc(C(=O)O)ccc1N
InChIInChI=1S/C9H7NO2/c1-2-6-5-7(9(11)12)3-4-8(6)10/h1,3-5H,10H2,(H,11,12)
InChIKeyPUWJKDDCTXOCBQ-UHFFFAOYSA-N
XLogP0.95
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500161.16
LogP ≤ 50.95
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 4-amino-3-ethynylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-3-ethynylbenzoic acid?
The IUPAC name of 4-amino-3-ethynylbenzoic acid (CID 55265470) is 4-amino-3-ethynylbenzoic acid.
What is the SMILES notation for 4-amino-3-ethynylbenzoic acid?
The canonical SMILES for 4-amino-3-ethynylbenzoic acid is C#Cc1cc(C(=O)O)ccc1N.
What is the InChIKey of 4-amino-3-ethynylbenzoic acid?
The InChIKey is PUWJKDDCTXOCBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2/c1-2-6-5-7(9(11)12)3-4-8(6)10/h1,3-5H,10H2,(H,11,12).
What are the key properties of 4-amino-3-ethynylbenzoic acid?
4-amino-3-ethynylbenzoic acid has a molecular weight of 161.16 g/mol, XLogP of 0.95, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-ethynylbenzoic acid is sourced from PubChem (CID 55265470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).