C11H15FN2 — CID 55275890
(1R)-5-fluoro-6-methyl-1,2,3,4-tetrahydronaphthalene-1,7-diamine (PubChem CID 55275890) has the molecular formula C11H15FN2 and a molecular weight of 194.25 g/mol. Its IUPAC name is (1R)-5-fluoro-6-methyl-1,2,3,4-tetrahydronaphthalene-1,7-diamine.
| Compound Name | (1R)-5-fluoro-6-methyl-1,2,3,4-tetrahydronaphthalene-1,7-diamine |
|---|---|
| PubChem CID | 55275890 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | (1R)-5-fluoro-6-methyl-1,2,3,4-tetrahydronaphthalene-1,7-diamine |
| SMILES | Cc1c(N)cc2c(c1F)CCC[C@H]2N |
| InChI | InChI=1S/C11H15FN2/c1-6-10(14)5-8-7(11(6)12)3-2-4-9(8)13/h5,9H,2-4,13-14H2,1H3/t9-/m1/s1 |
| InChIKey | FTCWDLZLASDDJE-SECBINFHSA-N |
| XLogP | 2.05 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|