About trimethylsilyl bis(3-trimethylsilyloxypropyl) phosphate
trimethylsilyl bis(3-trimethylsilyloxypropyl) phosphate (PubChem CID 552955) has the molecular formula C15H39O6PSi3
and a molecular weight of 430.70 g/mol. Its IUPAC name is trimethylsilyl bis(3-trimethylsilyloxypropyl) phosphate.
Molecular Properties
| Compound Name | trimethylsilyl bis(3-trimethylsilyloxypropyl) phosphate |
| PubChem CID | 552955 |
| Molecular Formula | C15H39O6PSi3 |
| Molecular Weight | 430.70 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | trimethylsilyl bis(3-trimethylsilyloxypropyl) phosphate |
| SMILES | C[Si](C)(C)OCCCOP(=O)(OCCCO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H39O6PSi3/c1-23(2,3)19-14-10-12-17-22(16,21-25(7,8)9)18-13-11-15-20-24(4,5)6/h10-15H2,1-9H3 |
| InChIKey | DMHIAAIIWLEFNE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.70 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze trimethylsilyl bis(3-trimethylsilyloxypropyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsilyl bis(3-trimethylsilyloxypropyl) phosphate?
The IUPAC name of trimethylsilyl bis(3-trimethylsilyloxypropyl) phosphate (CID 552955) is trimethylsilyl bis(3-trimethylsilyloxypropyl) phosphate.
What is the SMILES notation for trimethylsilyl bis(3-trimethylsilyloxypropyl) phosphate?
The canonical SMILES for trimethylsilyl bis(3-trimethylsilyloxypropyl) phosphate is C[Si](C)(C)OCCCOP(=O)(OCCCO[Si](C)(C)C)O[Si](C)(C)C.
What is the InChIKey of trimethylsilyl bis(3-trimethylsilyloxypropyl) phosphate?
The InChIKey is DMHIAAIIWLEFNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H39O6PSi3/c1-23(2,3)19-14-10-12-17-22(16,21-25(7,8)9)18-13-11-15-20-24(4,5)6/h10-15H2,1-9H3.
What are the key properties of trimethylsilyl bis(3-trimethylsilyloxypropyl) phosphate?
trimethylsilyl bis(3-trimethylsilyloxypropyl) phosphate has a molecular weight of 430.70 g/mol, XLogP of 5.46, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilyl bis(3-trimethylsilyloxypropyl) phosphate is sourced from PubChem (CID 552955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).