C12H17NO — CID 55297629
[3-(1-amino-2-cyclopropylethyl)phenyl]methanol (PubChem CID 55297629) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is [3-(1-amino-2-cyclopropylethyl)phenyl]methanol.
| Compound Name | [3-(1-amino-2-cyclopropylethyl)phenyl]methanol |
|---|---|
| PubChem CID | 55297629 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | [3-(1-amino-2-cyclopropylethyl)phenyl]methanol |
| SMILES | NC(CC1CC1)c1cccc(CO)c1 |
| InChI | InChI=1S/C12H17NO/c13-12(7-9-4-5-9)11-3-1-2-10(6-11)8-14/h1-3,6,9,12,14H,4-5,7-8,13H2 |
| InChIKey | CNGSSJQMFYOZHW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |