C7H14N2O — CID 55300349
1-but-3-enyl-1,3-dimethylurea (PubChem CID 55300349) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is 1-but-3-enyl-1,3-dimethylurea.
| Compound Name | 1-but-3-enyl-1,3-dimethylurea |
|---|---|
| PubChem CID | 55300349 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 1-but-3-enyl-1,3-dimethylurea |
| SMILES | C=CCCN(C)C(=O)NC |
| InChI | InChI=1S/C7H14N2O/c1-4-5-6-9(3)7(10)8-2/h4H,1,5-6H2,2-3H3,(H,8,10) |
| InChIKey | FEDNBQRDDUHJTB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|