About pent-4-enylurea
pent-4-enylurea (PubChem CID 55289982) has the molecular formula C6H12N2O
and a molecular weight of 128.17 g/mol. Its IUPAC name is pent-4-enylurea.
Molecular Properties
| Compound Name | pent-4-enylurea |
| PubChem CID | 55289982 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | pent-4-enylurea |
| SMILES | C=CCCCNC(N)=O |
| InChI | InChI=1S/C6H12N2O/c1-2-3-4-5-8-6(7)9/h2H,1,3-5H2,(H3,7,8,9) |
| InChIKey | VIVQFQRGRQHKHL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze pent-4-enylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-4-enylurea?
The IUPAC name of pent-4-enylurea (CID 55289982) is pent-4-enylurea.
What is the SMILES notation for pent-4-enylurea?
The canonical SMILES for pent-4-enylurea is C=CCCCNC(N)=O.
What is the InChIKey of pent-4-enylurea?
The InChIKey is VIVQFQRGRQHKHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O/c1-2-3-4-5-8-6(7)9/h2H,1,3-5H2,(H3,7,8,9).
What are the key properties of pent-4-enylurea?
pent-4-enylurea has a molecular weight of 128.17 g/mol, XLogP of 0.62, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pent-4-enylurea is sourced from PubChem (CID 55289982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).