C8H13ClO — CID 55303042
[(1S,6R)-6-(chloromethyl)cyclohex-3-en-1-yl]methanol (PubChem CID 55303042) has the molecular formula C8H13ClO and a molecular weight of 160.64 g/mol. Its IUPAC name is [(1S,6R)-6-(chloromethyl)cyclohex-3-en-1-yl]methanol.
| Compound Name | [(1S,6R)-6-(chloromethyl)cyclohex-3-en-1-yl]methanol |
|---|---|
| PubChem CID | 55303042 |
| Molecular Formula | C8H13ClO |
| Molecular Weight | 160.64 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | [(1S,6R)-6-(chloromethyl)cyclohex-3-en-1-yl]methanol |
| SMILES | OC[C@H]1CC=CC[C@H]1CCl |
| InChI | InChI=1S/C8H13ClO/c9-5-7-3-1-2-4-8(7)6-10/h1-2,7-8,10H,3-6H2/t7-,8+/m0/s1 |
| InChIKey | UHWCEZJUXSQFSB-JGVFFNPUSA-N |
| XLogP | 1.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.64 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|