C19H21ClN4OS — CID 55305598
N-[5-chloro-2-(dimethylamino)phenyl]-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide (PubChem CID 55305598) has the molecular formula C19H21ClN4OS and a molecular weight of 388.92 g/mol. Its IUPAC name is N-[5-chloro-2-(dimethylamino)phenyl]-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-[5-chloro-2-(dimethylamino)phenyl]-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 55305598 |
| Molecular Formula | C19H21ClN4OS |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N-[5-chloro-2-(dimethylamino)phenyl]-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide |
| SMILES | CCn1c(SCC(=O)Nc2cc(Cl)ccc2N(C)C)nc2ccccc21 |
| InChI | InChI=1S/C19H21ClN4OS/c1-4-24-17-8-6-5-7-14(17)22-19(24)26-12-18(25)21-15-11-13(20)9-10-16(15)23(2)3/h5-11H,4,12H2,1-3H3,(H,21,25) |
| InChIKey | AKYSTWNGSOUZDP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |