C19H16N4O7S2 — CID 55309752
[1-(3-nitroanilino)-1-oxopropan-2-yl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate (PubChem CID 55309752) has the molecular formula C19H16N4O7S2 and a molecular weight of 476.49 g/mol. Its IUPAC name is [1-(3-nitroanilino)-1-oxopropan-2-yl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate.
| Compound Name | [1-(3-nitroanilino)-1-oxopropan-2-yl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate |
|---|---|
| PubChem CID | 55309752 |
| Molecular Formula | C19H16N4O7S2 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | [1-(3-nitroanilino)-1-oxopropan-2-yl] 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate |
| SMILES | CC(OC(=O)c1ccc2c(c1)SC1=NS(=O)(=O)CCN12)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H16N4O7S2/c1-11(17(24)20-13-3-2-4-14(10-13)23(26)27)30-18(25)12-5-6-15-16(9-12)31-19-21-32(28,29)8-7-22(15)19/h2-6,9-11H,7-8H2,1H3,(H,20,24) |
| InChIKey | NHICGKXVGVISMJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 148.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|