C22H20ClN3O6S — CID 55316387
[2-(N-acetyl-2-chloro-4,6-dimethylanilino)-1,3-thiazol-4-yl]methyl 4-methoxy-3-nitrobenzoate (PubChem CID 55316387) has the molecular formula C22H20ClN3O6S and a molecular weight of 489.94 g/mol. Its IUPAC name is [2-(N-acetyl-2-chloro-4,6-dimethylanilino)-1,3-thiazol-4-yl]methyl 4-methoxy-3-nitrobenzoate.
| Compound Name | [2-(N-acetyl-2-chloro-4,6-dimethylanilino)-1,3-thiazol-4-yl]methyl 4-methoxy-3-nitrobenzoate |
|---|---|
| PubChem CID | 55316387 |
| Molecular Formula | C22H20ClN3O6S |
| Molecular Weight | 489.94 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | [2-(N-acetyl-2-chloro-4,6-dimethylanilino)-1,3-thiazol-4-yl]methyl 4-methoxy-3-nitrobenzoate |
| SMILES | COc1ccc(C(=O)OCc2csc(N(C(C)=O)c3c(C)cc(C)cc3Cl)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H20ClN3O6S/c1-12-7-13(2)20(17(23)8-12)25(14(3)27)22-24-16(11-33-22)10-32-21(28)15-5-6-19(31-4)18(9-15)26(29)30/h5-9,11H,10H2,1-4H3 |
| InChIKey | HXPYXYUMDWAYPS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 111.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.94 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|