C17H21NO6S — CID 55318575
methyl 1-[2-(4-oxo-4-thiophen-2-ylbutanoyl)oxyacetyl]piperidine-4-carboxylate (PubChem CID 55318575) has the molecular formula C17H21NO6S and a molecular weight of 367.42 g/mol. Its IUPAC name is methyl 1-[2-(4-oxo-4-thiophen-2-ylbutanoyl)oxyacetyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-(4-oxo-4-thiophen-2-ylbutanoyl)oxyacetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 55318575 |
| Molecular Formula | C17H21NO6S |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | methyl 1-[2-(4-oxo-4-thiophen-2-ylbutanoyl)oxyacetyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)COC(=O)CCC(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C17H21NO6S/c1-23-17(22)12-6-8-18(9-7-12)15(20)11-24-16(21)5-4-13(19)14-3-2-10-25-14/h2-3,10,12H,4-9,11H2,1H3 |
| InChIKey | RRLHNYDAYLCGKV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |