C18H17ClN2O4S — CID 55321524
[2-(benzylcarbamoylamino)-2-oxoethyl] 2-(4-chlorophenyl)sulfanylacetate (PubChem CID 55321524) has the molecular formula C18H17ClN2O4S and a molecular weight of 392.86 g/mol. Its IUPAC name is [2-(benzylcarbamoylamino)-2-oxoethyl] 2-(4-chlorophenyl)sulfanylacetate.
| Compound Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 2-(4-chlorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 55321524 |
| Molecular Formula | C18H17ClN2O4S |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 2-(4-chlorophenyl)sulfanylacetate |
| SMILES | O=C(COC(=O)CSc1ccc(Cl)cc1)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C18H17ClN2O4S/c19-14-6-8-15(9-7-14)26-12-17(23)25-11-16(22)21-18(24)20-10-13-4-2-1-3-5-13/h1-9H,10-12H2,(H2,20,21,22,24) |
| InChIKey | XKGCRGZPTFFGHR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |