C16H15ClN6O3S — CID 55323745
N'-[2-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-chlorobenzohydrazide (PubChem CID 55323745) has the molecular formula C16H15ClN6O3S and a molecular weight of 406.86 g/mol. Its IUPAC name is N'-[2-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-chlorobenzohydrazide.
| Compound Name | N'-[2-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-chlorobenzohydrazide |
|---|---|
| PubChem CID | 55323745 |
| Molecular Formula | C16H15ClN6O3S |
| Molecular Weight | 406.86 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | N'-[2-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-chlorobenzohydrazide |
| SMILES | Cc1occc1-c1nnc(SCC(=O)NNC(=O)c2ccccc2Cl)n1N |
| InChI | InChI=1S/C16H15ClN6O3S/c1-9-10(6-7-26-9)14-20-22-16(23(14)18)27-8-13(24)19-21-15(25)11-4-2-3-5-12(11)17/h2-7H,8,18H2,1H3,(H,19,24)(H,21,25) |
| InChIKey | YRQRQQJVGPIHOP-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 128.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.86 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|