C19H22F3N5O3 — CID 55328599
N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 55328599) has the molecular formula C19H22F3N5O3 and a molecular weight of 425.41 g/mol. Its IUPAC name is N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 55328599 |
| Molecular Formula | C19H22F3N5O3 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | CN(CC(=O)Nc1ccc(N2CCOCC2)cc1)C(=O)Cn1ccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C19H22F3N5O3/c1-25(18(29)13-27-7-6-16(24-27)19(20,21)22)12-17(28)23-14-2-4-15(5-3-14)26-8-10-30-11-9-26/h2-7H,8-13H2,1H3,(H,23,28) |
| InChIKey | MNJGTWGNXAEOAT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|