C21H26N4O5 — CID 8886433
[2-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate (PubChem CID 8886433) has the molecular formula C21H26N4O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is [2-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate.
| Compound Name | [2-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 8886433 |
| Molecular Formula | C21H26N4O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | [2-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate |
| SMILES | CN(CC(=O)Nc1ccc(N2CCOCC2)cc1)C(=O)COC(=O)c1cccn1C |
| InChI | InChI=1S/C21H26N4O5/c1-23-9-3-4-18(23)21(28)30-15-20(27)24(2)14-19(26)22-16-5-7-17(8-6-16)25-10-12-29-13-11-25/h3-9H,10-15H2,1-2H3,(H,22,26) |
| InChIKey | MFWWDLOYMKCGNG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|