C20H17ClF3N3O4 — CID 55331707
1-(5-chloro-2-methoxyphenyl)-5-oxo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]pyrrolidine-3-carboxamide (PubChem CID 55331707) has the molecular formula C20H17ClF3N3O4 and a molecular weight of 455.82 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-5-oxo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-5-oxo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55331707 |
| Molecular Formula | C20H17ClF3N3O4 |
| Molecular Weight | 455.82 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-5-oxo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]pyrrolidine-3-carboxamide |
| SMILES | COc1ccc(Cl)cc1N1CC(C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)CC1=O |
| InChI | InChI=1S/C20H17ClF3N3O4/c1-31-15-5-2-11(21)7-14(15)27-9-10(6-17(27)29)20(30)25-8-16(28)26-13-4-3-12(22)18(23)19(13)24/h2-5,7,10H,6,8-9H2,1H3,(H,25,30)(H,26,28) |
| InChIKey | RCWNEAMIJNKZCI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.82 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|