C21H25ClFN3O3S — CID 55334658
N-butan-2-yl-4-chloro-3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzamide (PubChem CID 55334658) has the molecular formula C21H25ClFN3O3S and a molecular weight of 453.97 g/mol. Its IUPAC name is N-butan-2-yl-4-chloro-3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzamide.
| Compound Name | N-butan-2-yl-4-chloro-3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 55334658 |
| Molecular Formula | C21H25ClFN3O3S |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | N-butan-2-yl-4-chloro-3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzamide |
| SMILES | CCC(C)NC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCN(c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C21H25ClFN3O3S/c1-3-15(2)24-21(27)16-4-9-19(22)20(14-16)30(28,29)26-12-10-25(11-13-26)18-7-5-17(23)6-8-18/h4-9,14-15H,3,10-13H2,1-2H3,(H,24,27) |
| InChIKey | ILNFPHYKPZZJIP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |