C20H22ClFN2O4S — CID 43004486
propan-2-yl 4-chloro-3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzoate (PubChem CID 43004486) has the molecular formula C20H22ClFN2O4S and a molecular weight of 440.92 g/mol. Its IUPAC name is propan-2-yl 4-chloro-3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzoate.
| Compound Name | propan-2-yl 4-chloro-3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 43004486 |
| Molecular Formula | C20H22ClFN2O4S |
| Molecular Weight | 440.92 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | propan-2-yl 4-chloro-3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzoate |
| SMILES | CC(C)OC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCN(c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C20H22ClFN2O4S/c1-14(2)28-20(25)15-3-8-18(21)19(13-15)29(26,27)24-11-9-23(10-12-24)17-6-4-16(22)5-7-17/h3-8,13-14H,9-12H2,1-2H3 |
| InChIKey | JDOLTVRFEVOVPL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.92 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |