C26H21N5O6 — CID 55336951
N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-(furan-2-ylmethyl)-N-methyl-1,3-dioxoisoindole-5-carboxamide (PubChem CID 55336951) has the molecular formula C26H21N5O6 and a molecular weight of 499.48 g/mol. Its IUPAC name is N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-(furan-2-ylmethyl)-N-methyl-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-(furan-2-ylmethyl)-N-methyl-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 55336951 |
| Molecular Formula | C26H21N5O6 |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-(furan-2-ylmethyl)-N-methyl-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CN(C(=O)c1ccc2c(c1)C(=O)N(Cc1ccco1)C2=O)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C26H21N5O6/c1-29(20-21(27)30(26(36)28-22(20)32)13-15-6-3-2-4-7-15)23(33)16-9-10-18-19(12-16)25(35)31(24(18)34)14-17-8-5-11-37-17/h2-12H,13-14,27H2,1H3,(H,28,32,36) |
| InChIKey | XJYNAJBLCKILEN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 151.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|