C24H20N2O6 — CID 4789733
methyl 2-[[2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carbonyl]amino]-3-phenylpropanoate (PubChem CID 4789733) has the molecular formula C24H20N2O6 and a molecular weight of 432.43 g/mol. Its IUPAC name is methyl 2-[[2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carbonyl]amino]-3-phenylpropanoate.
| Compound Name | methyl 2-[[2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 4789733 |
| Molecular Formula | C24H20N2O6 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | methyl 2-[[2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carbonyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)c1ccc2c(c1)C(=O)N(Cc1ccco1)C2=O |
| InChI | InChI=1S/C24H20N2O6/c1-31-24(30)20(12-15-6-3-2-4-7-15)25-21(27)16-9-10-18-19(13-16)23(29)26(22(18)28)14-17-8-5-11-32-17/h2-11,13,20H,12,14H2,1H3,(H,25,27) |
| InChIKey | RMWBDBKXPXFZJJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|