C20H31N3O5S2 — CID 55338802
N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetamide (PubChem CID 55338802) has the molecular formula C20H31N3O5S2 and a molecular weight of 457.62 g/mol. Its IUPAC name is N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetamide.
| Compound Name | N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetamide |
|---|---|
| PubChem CID | 55338802 |
| Molecular Formula | C20H31N3O5S2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(C)NC(=O)CSCC(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H31N3O5S2/c1-4-23(5-2)30(26,27)18-8-6-17(7-9-18)16(3)21-19(24)14-29-15-20(25)22-10-12-28-13-11-22/h6-9,16H,4-5,10-15H2,1-3H3,(H,21,24) |
| InChIKey | XCERFUGYZBKMNE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |