C23H38N4O5S — CID 55590371
1-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-3-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]urea (PubChem CID 55590371) has the molecular formula C23H38N4O5S and a molecular weight of 482.65 g/mol. Its IUPAC name is 1-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-3-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]urea.
| Compound Name | 1-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-3-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 55590371 |
| Molecular Formula | C23H38N4O5S |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | 1-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-3-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]urea |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(C)NC(=O)NCC(C2CCOC2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H38N4O5S/c1-4-27(5-2)33(29,30)21-8-6-19(7-9-21)18(3)25-23(28)24-16-22(20-10-13-32-17-20)26-11-14-31-15-12-26/h6-9,18,20,22H,4-5,10-17H2,1-3H3,(H2,24,25,28) |
| InChIKey | CDAQUVHDPJOCLN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |