C20H31N3O6S2 — CID 55337309
N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetamide (PubChem CID 55337309) has the molecular formula C20H31N3O6S2 and a molecular weight of 473.62 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetamide.
| Compound Name | N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetamide |
|---|---|
| PubChem CID | 55337309 |
| Molecular Formula | C20H31N3O6S2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetamide |
| SMILES | CCOc1ccc(NC(=O)CSCC(=O)N2CCOCC2)cc1S(=O)(=O)N(CC)CC |
| InChI | InChI=1S/C20H31N3O6S2/c1-4-23(5-2)31(26,27)18-13-16(7-8-17(18)29-6-3)21-19(24)14-30-15-20(25)22-9-11-28-12-10-22/h7-8,13H,4-6,9-12,14-15H2,1-3H3,(H,21,24) |
| InChIKey | CJEIYEMSHGQCOJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |