C27H24N2O6 — CID 55341064
N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxybenzamide (PubChem CID 55341064) has the molecular formula C27H24N2O6 and a molecular weight of 472.50 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxybenzamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxybenzamide |
|---|---|
| PubChem CID | 55341064 |
| Molecular Formula | C27H24N2O6 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxybenzamide |
| SMILES | CCOc1ccc(CN2C(=O)c3ccccc3C2=O)cc1C(=O)NCC1COc2ccccc2O1 |
| InChI | InChI=1S/C27H24N2O6/c1-2-33-22-12-11-17(15-29-26(31)19-7-3-4-8-20(19)27(29)32)13-21(22)25(30)28-14-18-16-34-23-9-5-6-10-24(23)35-18/h3-13,18H,2,14-16H2,1H3,(H,28,30) |
| InChIKey | CDCUXVPKXBLBBG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|