C17H16F3N3O2 — CID 55343312
N-[1-oxo-1-[2-[3-(trifluoromethyl)phenyl]hydrazinyl]propan-2-yl]benzamide (PubChem CID 55343312) has the molecular formula C17H16F3N3O2 and a molecular weight of 351.33 g/mol. Its IUPAC name is N-[1-oxo-1-[2-[3-(trifluoromethyl)phenyl]hydrazinyl]propan-2-yl]benzamide.
| Compound Name | N-[1-oxo-1-[2-[3-(trifluoromethyl)phenyl]hydrazinyl]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 55343312 |
| Molecular Formula | C17H16F3N3O2 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | N-[1-oxo-1-[2-[3-(trifluoromethyl)phenyl]hydrazinyl]propan-2-yl]benzamide |
| SMILES | CC(NC(=O)c1ccccc1)C(=O)NNc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H16F3N3O2/c1-11(21-16(25)12-6-3-2-4-7-12)15(24)23-22-14-9-5-8-13(10-14)17(18,19)20/h2-11,22H,1H3,(H,21,25)(H,23,24) |
| InChIKey | SRHVZLQQNIWCPO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|