C19H18F5N3O2 — CID 55343399
2,6-difluoro-N-[3-methyl-1-oxo-1-[2-[3-(trifluoromethyl)phenyl]hydrazinyl]butan-2-yl]benzamide (PubChem CID 55343399) has the molecular formula C19H18F5N3O2 and a molecular weight of 415.36 g/mol. Its IUPAC name is 2,6-difluoro-N-[3-methyl-1-oxo-1-[2-[3-(trifluoromethyl)phenyl]hydrazinyl]butan-2-yl]benzamide.
| Compound Name | 2,6-difluoro-N-[3-methyl-1-oxo-1-[2-[3-(trifluoromethyl)phenyl]hydrazinyl]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 55343399 |
| Molecular Formula | C19H18F5N3O2 |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 2,6-difluoro-N-[3-methyl-1-oxo-1-[2-[3-(trifluoromethyl)phenyl]hydrazinyl]butan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1c(F)cccc1F)C(=O)NNc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H18F5N3O2/c1-10(2)16(25-17(28)15-13(20)7-4-8-14(15)21)18(29)27-26-12-6-3-5-11(9-12)19(22,23)24/h3-10,16,26H,1-2H3,(H,25,28)(H,27,29) |
| InChIKey | MLBVPOJSRMMYFZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|