C17H23BrN2O5S — CID 55344069
methyl 2-[(2-bromo-5-pyrrolidin-1-ylsulfonylbenzoyl)amino]-3-methylbutanoate (PubChem CID 55344069) has the molecular formula C17H23BrN2O5S and a molecular weight of 447.35 g/mol. Its IUPAC name is methyl 2-[(2-bromo-5-pyrrolidin-1-ylsulfonylbenzoyl)amino]-3-methylbutanoate.
| Compound Name | methyl 2-[(2-bromo-5-pyrrolidin-1-ylsulfonylbenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55344069 |
| Molecular Formula | C17H23BrN2O5S |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | methyl 2-[(2-bromo-5-pyrrolidin-1-ylsulfonylbenzoyl)amino]-3-methylbutanoate |
| SMILES | COC(=O)C(NC(=O)c1cc(S(=O)(=O)N2CCCC2)ccc1Br)C(C)C |
| InChI | InChI=1S/C17H23BrN2O5S/c1-11(2)15(17(22)25-3)19-16(21)13-10-12(6-7-14(13)18)26(23,24)20-8-4-5-9-20/h6-7,10-11,15H,4-5,8-9H2,1-3H3,(H,19,21) |
| InChIKey | XFVDSVHNRIZZGL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |