C22H28F2N4O5S — CID 55344206
3-[2-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-8-ethyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 55344206) has the molecular formula C22H28F2N4O5S and a molecular weight of 498.55 g/mol. Its IUPAC name is 3-[2-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-8-ethyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[2-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-8-ethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 55344206 |
| Molecular Formula | C22H28F2N4O5S |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 3-[2-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-8-ethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)N1CCN(S(=O)(=O)c3c(F)cccc3F)CC1)C2=O |
| InChI | InChI=1S/C22H28F2N4O5S/c1-2-15-6-8-22(9-7-15)20(30)28(21(31)25-22)14-18(29)26-10-12-27(13-11-26)34(32,33)19-16(23)4-3-5-17(19)24/h3-5,15H,2,6-14H2,1H3,(H,25,31) |
| InChIKey | UVZGESAZLCCWPK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|