C20H21N5O4S2 — CID 55347003
10-methyl-12-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene (PubChem CID 55347003) has the molecular formula C20H21N5O4S2 and a molecular weight of 459.55 g/mol. Its IUPAC name is 10-methyl-12-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene.
| Compound Name | 10-methyl-12-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
|---|---|
| PubChem CID | 55347003 |
| Molecular Formula | C20H21N5O4S2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 10-methyl-12-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
| SMILES | Cc1nc(N2CCN(S(=O)(=O)c3ccccc3[N+](=O)[O-])CC2)c2c3c(sc2n1)CCC3 |
| InChI | InChI=1S/C20H21N5O4S2/c1-13-21-19(18-14-5-4-7-16(14)30-20(18)22-13)23-9-11-24(12-10-23)31(28,29)17-8-3-2-6-15(17)25(26)27/h2-3,6,8H,4-5,7,9-12H2,1H3 |
| InChIKey | LIQPNIYSTLVFJP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 109.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|