C26H30N6O2S2 — CID 4849622
2-[4-[10-(piperidin-1-ylmethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 4849622) has the molecular formula C26H30N6O2S2 and a molecular weight of 522.70 g/mol. Its IUPAC name is 2-[4-[10-(piperidin-1-ylmethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-[4-[10-(piperidin-1-ylmethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 4849622 |
| Molecular Formula | C26H30N6O2S2 |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 2-[4-[10-(piperidin-1-ylmethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | N#Cc1ccccc1S(=O)(=O)N1CCN(c2nc(CN3CCCCC3)nc3sc4c(c23)CCC4)CC1 |
| InChI | InChI=1S/C26H30N6O2S2/c27-17-19-7-2-3-10-22(19)36(33,34)32-15-13-31(14-16-32)25-24-20-8-6-9-21(20)35-26(24)29-23(28-25)18-30-11-4-1-5-12-30/h2-3,7,10H,1,4-6,8-9,11-16,18H2 |
| InChIKey | GLSJWJNJNGPAOL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |