C27H32N4O3 — CID 55347966
N,2,5-trimethyl-1-(2-methylphenyl)-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]pyrrole-3-carboxamide (PubChem CID 55347966) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is N,2,5-trimethyl-1-(2-methylphenyl)-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]pyrrole-3-carboxamide.
| Compound Name | N,2,5-trimethyl-1-(2-methylphenyl)-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55347966 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | N,2,5-trimethyl-1-(2-methylphenyl)-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]pyrrole-3-carboxamide |
| SMILES | Cc1ccccc1-n1c(C)cc(C(=O)N(C)CC(=O)Nc2ccc(N3CCOCC3)cc2)c1C |
| InChI | InChI=1S/C27H32N4O3/c1-19-7-5-6-8-25(19)31-20(2)17-24(21(31)3)27(33)29(4)18-26(32)28-22-9-11-23(12-10-22)30-13-15-34-16-14-30/h5-12,17H,13-16,18H2,1-4H3,(H,28,32) |
| InChIKey | UHOQTTZMFYZSMA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|