C21H32N4O3S2 — CID 55350202
N-[1-[2-[(2-methylcyclohexyl)carbamothioyl]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-2-phenoxyacetamide (PubChem CID 55350202) has the molecular formula C21H32N4O3S2 and a molecular weight of 452.65 g/mol. Its IUPAC name is N-[1-[2-[(2-methylcyclohexyl)carbamothioyl]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-2-phenoxyacetamide.
| Compound Name | N-[1-[2-[(2-methylcyclohexyl)carbamothioyl]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 55350202 |
| Molecular Formula | C21H32N4O3S2 |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | N-[1-[2-[(2-methylcyclohexyl)carbamothioyl]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-2-phenoxyacetamide |
| SMILES | CSCCC(NC(=O)COc1ccccc1)C(=O)NNC(=S)NC1CCCCC1C |
| InChI | InChI=1S/C21H32N4O3S2/c1-15-8-6-7-11-17(15)23-21(29)25-24-20(27)18(12-13-30-2)22-19(26)14-28-16-9-4-3-5-10-16/h3-5,9-10,15,17-18H,6-8,11-14H2,1-2H3,(H,22,26)(H,24,27)(H2,23,25,29) |
| InChIKey | APLFZVPVSKKFCJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|