C22H23N5O5S — CID 4845281
N-[4-methylsulfanyl-1-oxo-1-[2-(4-oxo-3H-phthalazine-1-carbonyl)hydrazinyl]butan-2-yl]-2-phenoxyacetamide (PubChem CID 4845281) has the molecular formula C22H23N5O5S and a molecular weight of 469.52 g/mol. Its IUPAC name is N-[4-methylsulfanyl-1-oxo-1-[2-(4-oxo-3H-phthalazine-1-carbonyl)hydrazinyl]butan-2-yl]-2-phenoxyacetamide.
| Compound Name | N-[4-methylsulfanyl-1-oxo-1-[2-(4-oxo-3H-phthalazine-1-carbonyl)hydrazinyl]butan-2-yl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 4845281 |
| Molecular Formula | C22H23N5O5S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | N-[4-methylsulfanyl-1-oxo-1-[2-(4-oxo-3H-phthalazine-1-carbonyl)hydrazinyl]butan-2-yl]-2-phenoxyacetamide |
| SMILES | CSCCC(NC(=O)COc1ccccc1)C(=O)NNC(=O)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C22H23N5O5S/c1-33-12-11-17(23-18(28)13-32-14-7-3-2-4-8-14)21(30)26-27-22(31)19-15-9-5-6-10-16(15)20(29)25-24-19/h2-10,17H,11-13H2,1H3,(H,23,28)(H,25,29)(H,26,30)(H,27,31) |
| InChIKey | LITAEOUNFZIQPH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 142.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|