C20H24N4O5 — CID 55351370
N-[4-[[1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]amino]phenyl]-2-methylpropanamide (PubChem CID 55351370) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is N-[4-[[1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]amino]phenyl]-2-methylpropanamide.
| Compound Name | N-[4-[[1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]amino]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 55351370 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | N-[4-[[1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]amino]phenyl]-2-methylpropanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)C(C)Nc1ccc(NC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C20H24N4O5/c1-12(2)19(25)22-15-7-5-14(6-8-15)21-13(3)20(26)23-17-11-16(24(27)28)9-10-18(17)29-4/h5-13,21H,1-4H3,(H,22,25)(H,23,26) |
| InChIKey | VLTVHZOAJQKPRM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|