C24H21F3N4O5 — CID 2437201
3-[[(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 2437201) has the molecular formula C24H21F3N4O5 and a molecular weight of 502.45 g/mol. Its IUPAC name is 3-[[(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[[(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 2437201 |
| Molecular Formula | C24H21F3N4O5 |
| Molecular Weight | 502.45 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 3-[[(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@H](C)Nc1cccc(C(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C24H21F3N4O5/c1-14(22(32)30-20-13-19(31(34)35)9-10-21(20)36-2)28-17-7-3-5-15(11-17)23(33)29-18-8-4-6-16(12-18)24(25,26)27/h3-14,28H,1-2H3,(H,29,33)(H,30,32)/t14-/m0/s1 |
| InChIKey | JPHWLLCHCCVHDG-AWEZNQCLSA-N |
| XLogP | 5.31 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|