C18H15FN2O7 — CID 55357138
[2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 2-methyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate (PubChem CID 55357138) has the molecular formula C18H15FN2O7 and a molecular weight of 390.32 g/mol. Its IUPAC name is [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 2-methyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate.
| Compound Name | [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 2-methyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate |
|---|---|
| PubChem CID | 55357138 |
| Molecular Formula | C18H15FN2O7 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 2-methyl-2,3-dihydro-1,4-benzodioxine-3-carboxylate |
| SMILES | CC1Oc2ccccc2OC1C(=O)OCC(=O)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H15FN2O7/c1-10-17(28-15-5-3-2-4-14(15)27-10)18(23)26-9-16(22)20-11-6-7-12(19)13(8-11)21(24)25/h2-8,10,17H,9H2,1H3,(H,20,22) |
| InChIKey | SKTHVQLQGNEGQY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|