C20H23NO6S — CID 55357476
[1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-(2-methyl-N-methylsulfonylanilino)acetate (PubChem CID 55357476) has the molecular formula C20H23NO6S and a molecular weight of 405.47 g/mol. Its IUPAC name is [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-(2-methyl-N-methylsulfonylanilino)acetate.
| Compound Name | [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-(2-methyl-N-methylsulfonylanilino)acetate |
|---|---|
| PubChem CID | 55357476 |
| Molecular Formula | C20H23NO6S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-(2-methyl-N-methylsulfonylanilino)acetate |
| SMILES | COc1ccc(C(=O)C(C)OC(=O)CN(c2ccccc2C)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H23NO6S/c1-14-7-5-6-8-18(14)21(28(4,24)25)13-19(22)27-15(2)20(23)16-9-11-17(26-3)12-10-16/h5-12,15H,13H2,1-4H3 |
| InChIKey | CJFGHOBHTBKAEE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |