C16H22N2O5S — CID 8957484
[(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-(2-methyl-N-methylsulfonylanilino)acetate (PubChem CID 8957484) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-(2-methyl-N-methylsulfonylanilino)acetate.
| Compound Name | [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-(2-methyl-N-methylsulfonylanilino)acetate |
|---|---|
| PubChem CID | 8957484 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-(2-methyl-N-methylsulfonylanilino)acetate |
| SMILES | C=CCNC(=O)[C@@H](C)OC(=O)CN(c1ccccc1C)S(C)(=O)=O |
| InChI | InChI=1S/C16H22N2O5S/c1-5-10-17-16(20)13(3)23-15(19)11-18(24(4,21)22)14-9-7-6-8-12(14)2/h5-9,13H,1,10-11H2,2-4H3,(H,17,20)/t13-/m1/s1 |
| InChIKey | DEGCJJNGKSZERZ-CYBMUJFWSA-N |
| XLogP | 0.99 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|