C17H18BrNO4S — CID 55357626
(2-bromophenyl)methyl 2-(2-methyl-N-methylsulfonylanilino)acetate (PubChem CID 55357626) has the molecular formula C17H18BrNO4S and a molecular weight of 412.31 g/mol. Its IUPAC name is (2-bromophenyl)methyl 2-(2-methyl-N-methylsulfonylanilino)acetate.
| Compound Name | (2-bromophenyl)methyl 2-(2-methyl-N-methylsulfonylanilino)acetate |
|---|---|
| PubChem CID | 55357626 |
| Molecular Formula | C17H18BrNO4S |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | (2-bromophenyl)methyl 2-(2-methyl-N-methylsulfonylanilino)acetate |
| SMILES | Cc1ccccc1N(CC(=O)OCc1ccccc1Br)S(C)(=O)=O |
| InChI | InChI=1S/C17H18BrNO4S/c1-13-7-3-6-10-16(13)19(24(2,21)22)11-17(20)23-12-14-8-4-5-9-15(14)18/h3-10H,11-12H2,1-2H3 |
| InChIKey | NWUVLPXBHJUOOV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |