C13H16N2O4S — CID 8508313
[(1S)-1-cyanoethyl] 2-(2-methyl-N-methylsulfonylanilino)acetate (PubChem CID 8508313) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is [(1S)-1-cyanoethyl] 2-(2-methyl-N-methylsulfonylanilino)acetate.
| Compound Name | [(1S)-1-cyanoethyl] 2-(2-methyl-N-methylsulfonylanilino)acetate |
|---|---|
| PubChem CID | 8508313 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | [(1S)-1-cyanoethyl] 2-(2-methyl-N-methylsulfonylanilino)acetate |
| SMILES | Cc1ccccc1N(CC(=O)O[C@@H](C)C#N)S(C)(=O)=O |
| InChI | InChI=1S/C13H16N2O4S/c1-10-6-4-5-7-12(10)15(20(3,17)18)9-13(16)19-11(2)8-14/h4-7,11H,9H2,1-3H3/t11-/m0/s1 |
| InChIKey | VZUBJGKKGCIPHF-NSHDSACASA-N |
| XLogP | 1.22 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |