C18H22ClNOS — CID 55361168
N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-2-phenylpentanamide (PubChem CID 55361168) has the molecular formula C18H22ClNOS and a molecular weight of 335.90 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-2-phenylpentanamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-2-phenylpentanamide |
|---|---|
| PubChem CID | 55361168 |
| Molecular Formula | C18H22ClNOS |
| Molecular Weight | 335.90 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-2-phenylpentanamide |
| SMILES | CCCC(C(=O)N(CC)Cc1ccc(Cl)s1)c1ccccc1 |
| InChI | InChI=1S/C18H22ClNOS/c1-3-8-16(14-9-6-5-7-10-14)18(21)20(4-2)13-15-11-12-17(19)22-15/h5-7,9-12,16H,3-4,8,13H2,1-2H3 |
| InChIKey | HAUBFNCIXVRSHH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.90 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |