C20H23N3O3S — CID 55363866
N-(2,3-dimethyl-5-sulfamoylphenyl)-4-(1H-indol-3-yl)butanamide (PubChem CID 55363866) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is N-(2,3-dimethyl-5-sulfamoylphenyl)-4-(1H-indol-3-yl)butanamide.
| Compound Name | N-(2,3-dimethyl-5-sulfamoylphenyl)-4-(1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 55363866 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | N-(2,3-dimethyl-5-sulfamoylphenyl)-4-(1H-indol-3-yl)butanamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(NC(=O)CCCc2c[nH]c3ccccc23)c1C |
| InChI | InChI=1S/C20H23N3O3S/c1-13-10-16(27(21,25)26)11-19(14(13)2)23-20(24)9-5-6-15-12-22-18-8-4-3-7-17(15)18/h3-4,7-8,10-12,22H,5-6,9H2,1-2H3,(H,23,24)(H2,21,25,26) |
| InChIKey | XERBIDSUYLOBOO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |