C21H24N2O3S — CID 119048650
N-[(2,4-dimethylphenyl)methylsulfonyl]-4-(1H-indol-3-yl)butanamide (PubChem CID 119048650) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)methylsulfonyl]-4-(1H-indol-3-yl)butanamide.
| Compound Name | N-[(2,4-dimethylphenyl)methylsulfonyl]-4-(1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 119048650 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-[(2,4-dimethylphenyl)methylsulfonyl]-4-(1H-indol-3-yl)butanamide |
| SMILES | Cc1ccc(CS(=O)(=O)NC(=O)CCCc2c[nH]c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C21H24N2O3S/c1-15-10-11-18(16(2)12-15)14-27(25,26)23-21(24)9-5-6-17-13-22-20-8-4-3-7-19(17)20/h3-4,7-8,10-13,22H,5-6,9,14H2,1-2H3,(H,23,24) |
| InChIKey | LWRSWZYIJGGEOW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |